About 1-O-ethyl 5-O-[[(1-methylpyridin-1-ium-3-carbonyl)amino]methyl] pentanedioate iodide
1-O-ethyl 5-O-[[(1-methylpyridin-1-ium-3-carbonyl)amino]methyl] pentanedioate iodide (PubChem CID 138705852) has the molecular formula C15H21IN2O5
and a molecular weight of 436.25 g/mol. Its IUPAC name is 1-O-ethyl 5-O-[[(1-methylpyridin-1-ium-3-carbonyl)amino]methyl] pentanedioate iodide.
Molecular Properties
| Compound Name | 1-O-ethyl 5-O-[[(1-methylpyridin-1-ium-3-carbonyl)amino]methyl] pentanedioate iodide |
| PubChem CID | 138705852 |
| Molecular Formula | C15H21IN2O5 |
| Molecular Weight | 436.25 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | 1-O-ethyl 5-O-[[(1-methylpyridin-1-ium-3-carbonyl)amino]methyl] pentanedioate iodide |
| SMILES | CCOC(=O)CCCC(=O)OCNC(=O)c1ccc[n+](C)c1.[I-] |
| InChI | InChI=1S/C15H20N2O5.HI/c1-3-21-13(18)7-4-8-14(19)22-11-16-15(20)12-6-5-9-17(2)10-12;/h5-6,9-10H,3-4,7-8,11H2,1-2H3;1H |
| InChIKey | KGSGXTAYBZGCET-UHFFFAOYSA-N |
| XLogP | -2.52 |
| TPSA | 85.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.25 |
| LogP ≤ 5 | -2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-O-ethyl 5-O-[[(1-methylpyridin-1-ium-3-carbonyl)amino]methyl] pentanedioate iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-ethyl 5-O-[[(1-methylpyridin-1-ium-3-carbonyl)amino]methyl] pentanedioate iodide?
The IUPAC name of 1-O-ethyl 5-O-[[(1-methylpyridin-1-ium-3-carbonyl)amino]methyl] pentanedioate iodide (CID 138705852) is 1-O-ethyl 5-O-[[(1-methylpyridin-1-ium-3-carbonyl)amino]methyl] pentanedioate iodide.
What is the SMILES notation for 1-O-ethyl 5-O-[[(1-methylpyridin-1-ium-3-carbonyl)amino]methyl] pentanedioate iodide?
The canonical SMILES for 1-O-ethyl 5-O-[[(1-methylpyridin-1-ium-3-carbonyl)amino]methyl] pentanedioate iodide is CCOC(=O)CCCC(=O)OCNC(=O)c1ccc[n+](C)c1.[I-].
What is the InChIKey of 1-O-ethyl 5-O-[[(1-methylpyridin-1-ium-3-carbonyl)amino]methyl] pentanedioate iodide?
The InChIKey is KGSGXTAYBZGCET-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O5.HI/c1-3-21-13(18)7-4-8-14(19)22-11-16-15(20)12-6-5-9-17(2)10-12;/h5-6,9-10H,3-4,7-8,11H2,1-2H3;1H.
What are the key properties of 1-O-ethyl 5-O-[[(1-methylpyridin-1-ium-3-carbonyl)amino]methyl] pentanedioate iodide?
1-O-ethyl 5-O-[[(1-methylpyridin-1-ium-3-carbonyl)amino]methyl] pentanedioate iodide has a molecular weight of 436.25 g/mol, XLogP of -2.52, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-ethyl 5-O-[[(1-methylpyridin-1-ium-3-carbonyl)amino]methyl] pentanedioate iodide is sourced from PubChem (CID 138705852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).