C11H14N2O3 — CID 138705851
(pyridine-3-carbonylamino)methyl butanoate (PubChem CID 138705851) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is (pyridine-3-carbonylamino)methyl butanoate.
| Compound Name | (pyridine-3-carbonylamino)methyl butanoate |
|---|---|
| PubChem CID | 138705851 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | (pyridine-3-carbonylamino)methyl butanoate |
| SMILES | CCCC(=O)OCNC(=O)c1cccnc1 |
| InChI | InChI=1S/C11H14N2O3/c1-2-4-10(14)16-8-13-11(15)9-5-3-6-12-7-9/h3,5-7H,2,4,8H2,1H3,(H,13,15) |
| InChIKey | ATXBJKPNTKMBOB-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|