C13H19N2O3+ — CID 163204268
[(1-methylpyridin-1-ium-3-carbonyl)amino]methyl 2,2-dimethylpropanoate (PubChem CID 163204268) has the molecular formula C13H19N2O3+ and a molecular weight of 251.31 g/mol. Its IUPAC name is [(1-methylpyridin-1-ium-3-carbonyl)amino]methyl 2,2-dimethylpropanoate.
| Compound Name | [(1-methylpyridin-1-ium-3-carbonyl)amino]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 163204268 |
| Molecular Formula | C13H19N2O3+ |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | [(1-methylpyridin-1-ium-3-carbonyl)amino]methyl 2,2-dimethylpropanoate |
| SMILES | C[n+]1cccc(C(=O)NCOC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C13H18N2O3/c1-13(2,3)12(17)18-9-14-11(16)10-6-5-7-15(4)8-10/h5-8H,9H2,1-4H3/p+1 |
| InChIKey | IKYRFUYATPWOAM-UHFFFAOYSA-O |
| XLogP | 0.79 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|