About [(1-methylpyridin-1-ium-3-carbonyl)amino]methyl 2-methylpropanoate iodide
[(1-methylpyridin-1-ium-3-carbonyl)amino]methyl 2-methylpropanoate iodide (PubChem CID 138705814) has the molecular formula C12H17IN2O3
and a molecular weight of 364.18 g/mol. Its IUPAC name is [(1-methylpyridin-1-ium-3-carbonyl)amino]methyl 2-methylpropanoate iodide.
Molecular Properties
| Compound Name | [(1-methylpyridin-1-ium-3-carbonyl)amino]methyl 2-methylpropanoate iodide |
| PubChem CID | 138705814 |
| Molecular Formula | C12H17IN2O3 |
| Molecular Weight | 364.18 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | [(1-methylpyridin-1-ium-3-carbonyl)amino]methyl 2-methylpropanoate iodide |
| SMILES | CC(C)C(=O)OCNC(=O)c1ccc[n+](C)c1.[I-] |
| InChI | InChI=1S/C12H16N2O3.HI/c1-9(2)12(16)17-8-13-11(15)10-5-4-6-14(3)7-10;/h4-7,9H,8H2,1-3H3;1H |
| InChIKey | OUNISYCSMBXYCR-UHFFFAOYSA-N |
| XLogP | -2.60 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.18 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze [(1-methylpyridin-1-ium-3-carbonyl)amino]methyl 2-methylpropanoate iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1-methylpyridin-1-ium-3-carbonyl)amino]methyl 2-methylpropanoate iodide?
The IUPAC name of [(1-methylpyridin-1-ium-3-carbonyl)amino]methyl 2-methylpropanoate iodide (CID 138705814) is [(1-methylpyridin-1-ium-3-carbonyl)amino]methyl 2-methylpropanoate iodide.
What is the SMILES notation for [(1-methylpyridin-1-ium-3-carbonyl)amino]methyl 2-methylpropanoate iodide?
The canonical SMILES for [(1-methylpyridin-1-ium-3-carbonyl)amino]methyl 2-methylpropanoate iodide is CC(C)C(=O)OCNC(=O)c1ccc[n+](C)c1.[I-].
What is the InChIKey of [(1-methylpyridin-1-ium-3-carbonyl)amino]methyl 2-methylpropanoate iodide?
The InChIKey is OUNISYCSMBXYCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O3.HI/c1-9(2)12(16)17-8-13-11(15)10-5-4-6-14(3)7-10;/h4-7,9H,8H2,1-3H3;1H.
What are the key properties of [(1-methylpyridin-1-ium-3-carbonyl)amino]methyl 2-methylpropanoate iodide?
[(1-methylpyridin-1-ium-3-carbonyl)amino]methyl 2-methylpropanoate iodide has a molecular weight of 364.18 g/mol, XLogP of -2.60, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1-methylpyridin-1-ium-3-carbonyl)amino]methyl 2-methylpropanoate iodide is sourced from PubChem (CID 138705814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).