C17H25IN2O3 — CID 22402671
cyclohexyl 2-[(1-methylpyridin-1-ium-3-carbonyl)amino]butanoate iodide (PubChem CID 22402671) has the molecular formula C17H25IN2O3 and a molecular weight of 432.30 g/mol. Its IUPAC name is cyclohexyl 2-[(1-methylpyridin-1-ium-3-carbonyl)amino]butanoate iodide.
| Compound Name | cyclohexyl 2-[(1-methylpyridin-1-ium-3-carbonyl)amino]butanoate iodide |
|---|---|
| PubChem CID | 22402671 |
| Molecular Formula | C17H25IN2O3 |
| Molecular Weight | 432.30 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | cyclohexyl 2-[(1-methylpyridin-1-ium-3-carbonyl)amino]butanoate iodide |
| SMILES | CCC(NC(=O)c1ccc[n+](C)c1)C(=O)OC1CCCCC1.[I-] |
| InChI | InChI=1S/C17H24N2O3.HI/c1-3-15(17(21)22-14-9-5-4-6-10-14)18-16(20)13-8-7-11-19(2)12-13;/h7-8,11-12,14-15H,3-6,9-10H2,1-2H3;1H |
| InChIKey | CQHCWIBZQDUJAI-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.30 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|