C14H21IN2O — CID 139055719
[(2S,6R)-2,6-dimethylpiperidin-1-yl]-(1-methylpyridin-1-ium-3-yl)methanone iodide (PubChem CID 139055719) has the molecular formula C14H21IN2O and a molecular weight of 360.24 g/mol. Its IUPAC name is [(2S,6R)-2,6-dimethylpiperidin-1-yl]-(1-methylpyridin-1-ium-3-yl)methanone iodide.
| Compound Name | [(2S,6R)-2,6-dimethylpiperidin-1-yl]-(1-methylpyridin-1-ium-3-yl)methanone iodide |
|---|---|
| PubChem CID | 139055719 |
| Molecular Formula | C14H21IN2O |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | [(2S,6R)-2,6-dimethylpiperidin-1-yl]-(1-methylpyridin-1-ium-3-yl)methanone iodide |
| SMILES | C[C@@H]1CCC[C@H](C)N1C(=O)c1ccc[n+](C)c1.[I-] |
| InChI | InChI=1S/C14H21N2O.HI/c1-11-6-4-7-12(2)16(11)14(17)13-8-5-9-15(3)10-13;/h5,8-12H,4,6-7H2,1-3H3;1H/q+1;/p-1/t11-,12+; |
| InChIKey | WSWCDRAMKBMLPB-IWKKHLOMSA-M |
| XLogP | -1.08 |
| TPSA | 24.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|