C14H20N2O — CID 30115915
(4-aminophenyl)-[(2S,6S)-2,6-dimethylpiperidin-1-yl]methanone (PubChem CID 30115915) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is (4-aminophenyl)-[(2S,6S)-2,6-dimethylpiperidin-1-yl]methanone.
| Compound Name | (4-aminophenyl)-[(2S,6S)-2,6-dimethylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 30115915 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | (4-aminophenyl)-[(2S,6S)-2,6-dimethylpiperidin-1-yl]methanone |
| SMILES | C[C@H]1CCC[C@H](C)N1C(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C14H20N2O/c1-10-4-3-5-11(2)16(10)14(17)12-6-8-13(15)9-7-12/h6-11H,3-5,15H2,1-2H3/t10-,11-/m0/s1 |
| InChIKey | RJVODUZLXDHLBY-QWRGUYRKSA-N |
| XLogP | 2.67 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|