C12H17NO2 — CID 128538257
(2,6-dimethylpiperidin-1-yl)-(furan-3-yl)methanone (PubChem CID 128538257) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is (2,6-dimethylpiperidin-1-yl)-(furan-3-yl)methanone.
| Compound Name | (2,6-dimethylpiperidin-1-yl)-(furan-3-yl)methanone |
|---|---|
| PubChem CID | 128538257 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | (2,6-dimethylpiperidin-1-yl)-(furan-3-yl)methanone |
| SMILES | CC1CCCC(C)N1C(=O)c1ccoc1 |
| InChI | InChI=1S/C12H17NO2/c1-9-4-3-5-10(2)13(9)12(14)11-6-7-15-8-11/h6-10H,3-5H2,1-2H3 |
| InChIKey | SHFSINMRSKXUDO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |