C14H19NOS — CID 107036490
[(2S,6R)-2,6-dimethylpiperidin-1-yl]-(3-sulfanylphenyl)methanone (PubChem CID 107036490) has the molecular formula C14H19NOS and a molecular weight of 249.38 g/mol. Its IUPAC name is [(2S,6R)-2,6-dimethylpiperidin-1-yl]-(3-sulfanylphenyl)methanone.
| Compound Name | [(2S,6R)-2,6-dimethylpiperidin-1-yl]-(3-sulfanylphenyl)methanone |
|---|---|
| PubChem CID | 107036490 |
| Molecular Formula | C14H19NOS |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | [(2S,6R)-2,6-dimethylpiperidin-1-yl]-(3-sulfanylphenyl)methanone |
| SMILES | C[C@@H]1CCC[C@H](C)N1C(=O)c1cccc(S)c1 |
| InChI | InChI=1S/C14H19NOS/c1-10-5-3-6-11(2)15(10)14(16)12-7-4-8-13(17)9-12/h4,7-11,17H,3,5-6H2,1-2H3/t10-,11+ |
| InChIKey | CZEAPGYSHGWNGX-PHIMTYICSA-N |
| XLogP | 3.38 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|