C25H29ClN3O7+ — CID 155011695
3-chloro-2-[[1-[[(2R)-2-(2-methoxy-2-oxo-1-phenylethyl)piperidine-1-carbonyl]oxymethyl]pyridin-1-ium-3-carbonyl]amino]propanoic acid (PubChem CID 155011695) has the molecular formula C25H29ClN3O7+ and a molecular weight of 518.97 g/mol. Its IUPAC name is 3-chloro-2-[[1-[[(2R)-2-(2-methoxy-2-oxo-1-phenylethyl)piperidine-1-carbonyl]oxymethyl]pyridin-1-ium-3-carbonyl]amino]propanoic acid.
| Compound Name | 3-chloro-2-[[1-[[(2R)-2-(2-methoxy-2-oxo-1-phenylethyl)piperidine-1-carbonyl]oxymethyl]pyridin-1-ium-3-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 155011695 |
| Molecular Formula | C25H29ClN3O7+ |
| Molecular Weight | 518.97 g/mol |
| Exact Mass | 518.17 |
| IUPAC Name | 3-chloro-2-[[1-[[(2R)-2-(2-methoxy-2-oxo-1-phenylethyl)piperidine-1-carbonyl]oxymethyl]pyridin-1-ium-3-carbonyl]amino]propanoic acid |
| SMILES | COC(=O)C(c1ccccc1)[C@H]1CCCCN1C(=O)OC[n+]1cccc(C(=O)NC(CCl)C(=O)O)c1 |
| InChI | InChI=1S/C25H28ClN3O7/c1-35-24(33)21(17-8-3-2-4-9-17)20-11-5-6-13-29(20)25(34)36-16-28-12-7-10-18(15-28)22(30)27-19(14-26)23(31)32/h2-4,7-10,12,15,19-21H,5-6,11,13-14,16H2,1H3,(H-,27,30,31,32)/p+1/t19?,20-,21?/m1/s1 |
| InChIKey | ZRAFYDYTQDLQOS-NYLDSWQDSA-O |
| XLogP | 2.30 |
| TPSA | 126.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.97 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|