C20H28N2O4 — CID 89400071
2-(prop-1-en-2-ylamino)ethyl 2-(2-methoxy-2-oxo-1-phenylethyl)piperidine-1-carboxylate (PubChem CID 89400071) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is 2-(prop-1-en-2-ylamino)ethyl 2-(2-methoxy-2-oxo-1-phenylethyl)piperidine-1-carboxylate.
| Compound Name | 2-(prop-1-en-2-ylamino)ethyl 2-(2-methoxy-2-oxo-1-phenylethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 89400071 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 2-(prop-1-en-2-ylamino)ethyl 2-(2-methoxy-2-oxo-1-phenylethyl)piperidine-1-carboxylate |
| SMILES | C=C(C)NCCOC(=O)N1CCCCC1C(C(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C20H28N2O4/c1-15(2)21-12-14-26-20(24)22-13-8-7-11-17(22)18(19(23)25-3)16-9-5-4-6-10-16/h4-6,9-10,17-18,21H,1,7-8,11-14H2,2-3H3 |
| InChIKey | WVHOHDHQRNSXRR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|