C32H42N2O7 — CID 161243138
(9-amino-8-oxo-10-phenyldecanoyl)oxymethyl 2-(2-methoxy-2-oxo-1-phenylethyl)piperidine-1-carboxylate (PubChem CID 161243138) has the molecular formula C32H42N2O7 and a molecular weight of 566.70 g/mol. Its IUPAC name is (9-amino-8-oxo-10-phenyldecanoyl)oxymethyl 2-(2-methoxy-2-oxo-1-phenylethyl)piperidine-1-carboxylate.
| Compound Name | (9-amino-8-oxo-10-phenyldecanoyl)oxymethyl 2-(2-methoxy-2-oxo-1-phenylethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 161243138 |
| Molecular Formula | C32H42N2O7 |
| Molecular Weight | 566.70 g/mol |
| Exact Mass | 566.30 |
| IUPAC Name | (9-amino-8-oxo-10-phenyldecanoyl)oxymethyl 2-(2-methoxy-2-oxo-1-phenylethyl)piperidine-1-carboxylate |
| SMILES | COC(=O)C(c1ccccc1)C1CCCCN1C(=O)OCOC(=O)CCCCCCC(=O)C(N)Cc1ccccc1 |
| InChI | InChI=1S/C32H42N2O7/c1-39-31(37)30(25-16-8-5-9-17-25)27-18-12-13-21-34(27)32(38)41-23-40-29(36)20-11-3-2-10-19-28(35)26(33)22-24-14-6-4-7-15-24/h4-9,14-17,26-27,30H,2-3,10-13,18-23,33H2,1H3 |
| InChIKey | VAGTZVDKTBHMND-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 125.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.70 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|