C16H22NO8P — CID 71244658
phosphonooxymethyl 2-(2-methoxy-2-oxo-1-phenylethyl)piperidine-1-carboxylate (PubChem CID 71244658) has the molecular formula C16H22NO8P and a molecular weight of 387.33 g/mol. Its IUPAC name is phosphonooxymethyl 2-(2-methoxy-2-oxo-1-phenylethyl)piperidine-1-carboxylate.
| Compound Name | phosphonooxymethyl 2-(2-methoxy-2-oxo-1-phenylethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71244658 |
| Molecular Formula | C16H22NO8P |
| Molecular Weight | 387.33 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | phosphonooxymethyl 2-(2-methoxy-2-oxo-1-phenylethyl)piperidine-1-carboxylate |
| SMILES | COC(=O)C(c1ccccc1)C1CCCCN1C(=O)OCOP(=O)(O)O |
| InChI | InChI=1S/C16H22NO8P/c1-23-15(18)14(12-7-3-2-4-8-12)13-9-5-6-10-17(13)16(19)24-11-25-26(20,21)22/h2-4,7-8,13-14H,5-6,9-11H2,1H3,(H2,20,21,22) |
| InChIKey | BSQJCMALWXPBND-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|