C17H26NO4P — CID 170067038
cyclohexyl (2S)-2-[[ethyl(phenoxy)phosphoryl]amino]propanoate (PubChem CID 170067038) has the molecular formula C17H26NO4P and a molecular weight of 339.37 g/mol. Its IUPAC name is cyclohexyl (2S)-2-[[ethyl(phenoxy)phosphoryl]amino]propanoate.
| Compound Name | cyclohexyl (2S)-2-[[ethyl(phenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 170067038 |
| Molecular Formula | C17H26NO4P |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | cyclohexyl (2S)-2-[[ethyl(phenoxy)phosphoryl]amino]propanoate |
| SMILES | CCP(=O)(N[C@@H](C)C(=O)OC1CCCCC1)Oc1ccccc1 |
| InChI | InChI=1S/C17H26NO4P/c1-3-23(20,22-16-12-8-5-9-13-16)18-14(2)17(19)21-15-10-6-4-7-11-15/h5,8-9,12-15H,3-4,6-7,10-11H2,1-2H3,(H,18,20)/t14-,23?/m0/s1 |
| InChIKey | DIMIIMFYBAGRGB-JRQMZCAUSA-N |
| XLogP | 4.13 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|