C10H19ClNO3P — CID 90251497
cyclohexyl (2S)-2-[[chloro(methyl)phosphoryl]amino]propanoate (PubChem CID 90251497) has the molecular formula C10H19ClNO3P and a molecular weight of 267.69 g/mol. Its IUPAC name is cyclohexyl (2S)-2-[[chloro(methyl)phosphoryl]amino]propanoate.
| Compound Name | cyclohexyl (2S)-2-[[chloro(methyl)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 90251497 |
| Molecular Formula | C10H19ClNO3P |
| Molecular Weight | 267.69 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | cyclohexyl (2S)-2-[[chloro(methyl)phosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(C)(=O)Cl)C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C10H19ClNO3P/c1-8(12-16(2,11)14)10(13)15-9-6-4-3-5-7-9/h8-9H,3-7H2,1-2H3,(H,12,14)/t8-,16?/m0/s1 |
| InChIKey | UVLJPERFTMQSOS-UOCSPZAXSA-N |
| XLogP | 2.90 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.69 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|