C15H17N2O2+ — CID 3578527
N-[2-(4-hydroxyphenyl)ethyl]-1-methylpyridin-1-ium-3-carboxamide (PubChem CID 3578527) has the molecular formula C15H17N2O2+ and a molecular weight of 257.31 g/mol. Its IUPAC name is N-[2-(4-hydroxyphenyl)ethyl]-1-methylpyridin-1-ium-3-carboxamide.
| Compound Name | N-[2-(4-hydroxyphenyl)ethyl]-1-methylpyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 3578527 |
| Molecular Formula | C15H17N2O2+ |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | N-[2-(4-hydroxyphenyl)ethyl]-1-methylpyridin-1-ium-3-carboxamide |
| SMILES | C[n+]1cccc(C(=O)NCCc2ccc(O)cc2)c1 |
| InChI | InChI=1S/C15H16N2O2/c1-17-10-2-3-13(11-17)15(19)16-9-8-12-4-6-14(18)7-5-12/h2-7,10-11H,8-9H2,1H3,(H-,16,18,19)/p+1 |
| InChIKey | VYELFLJYZOPGLF-UHFFFAOYSA-O |
| XLogP | 1.19 |
| TPSA | 53.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|