C27H33F3N2O7 — CID 14750685
[2-(2,2-dimethylpropanoyloxy)-4-[2-[(1-methylpyridin-1-ium-3-carbonyl)amino]ethyl]phenyl] 2,2-dimethylpropanoate;2,2,2-trifluoroacetate (PubChem CID 14750685) has the molecular formula C27H33F3N2O7 and a molecular weight of 554.56 g/mol. Its IUPAC name is [2-(2,2-dimethylpropanoyloxy)-4-[2-[(1-methylpyridin-1-ium-3-carbonyl)amino]ethyl]phenyl] 2,2-dimethylpropanoate;2,2,2-trifluoroacetate.
| Compound Name | [2-(2,2-dimethylpropanoyloxy)-4-[2-[(1-methylpyridin-1-ium-3-carbonyl)amino]ethyl]phenyl] 2,2-dimethylpropanoate;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 14750685 |
| Molecular Formula | C27H33F3N2O7 |
| Molecular Weight | 554.56 g/mol |
| Exact Mass | 554.22 |
| IUPAC Name | [2-(2,2-dimethylpropanoyloxy)-4-[2-[(1-methylpyridin-1-ium-3-carbonyl)amino]ethyl]phenyl] 2,2-dimethylpropanoate;2,2,2-trifluoroacetate |
| SMILES | C[n+]1cccc(C(=O)NCCc2ccc(OC(=O)C(C)(C)C)c(OC(=O)C(C)(C)C)c2)c1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C25H32N2O5.C2HF3O2/c1-24(2,3)22(29)31-19-11-10-17(15-20(19)32-23(30)25(4,5)6)12-13-26-21(28)18-9-8-14-27(7)16-18;3-2(4,5)1(6)7/h8-11,14-16H,12-13H2,1-7H3;(H,6,7) |
| InChIKey | PNSJBFDKTMJDLY-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 125.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.56 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|