C20H18N2O4S — CID 54281559
2-[(4-oxo-6-phenyl-2-sulfanylidenepyrimidin-1-yl)methoxy]ethyl benzoate (PubChem CID 54281559) has the molecular formula C20H18N2O4S and a molecular weight of 382.44 g/mol. Its IUPAC name is 2-[(4-oxo-6-phenyl-2-sulfanylidenepyrimidin-1-yl)methoxy]ethyl benzoate.
| Compound Name | 2-[(4-oxo-6-phenyl-2-sulfanylidenepyrimidin-1-yl)methoxy]ethyl benzoate |
|---|---|
| PubChem CID | 54281559 |
| Molecular Formula | C20H18N2O4S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 2-[(4-oxo-6-phenyl-2-sulfanylidenepyrimidin-1-yl)methoxy]ethyl benzoate |
| SMILES | O=C(OCCOCn1c(-c2ccccc2)cc(=O)[nH]c1=S)c1ccccc1 |
| InChI | InChI=1S/C20H18N2O4S/c23-18-13-17(15-7-3-1-4-8-15)22(20(27)21-18)14-25-11-12-26-19(24)16-9-5-2-6-10-16/h1-10,13H,11-12,14H2,(H,21,23,27) |
| InChIKey | RRDDJBVUEODDLK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|