C21H38N2O5SSi2 — CID 175677702
1-[(6aR,8R,9aS)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-4-sulfanylidenepyrimidin-2-one (PubChem CID 175677702) has the molecular formula C21H38N2O5SSi2 and a molecular weight of 486.78 g/mol. Its IUPAC name is 1-[(6aR,8R,9aS)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-4-sulfanylidenepyrimidin-2-one.
| Compound Name | 1-[(6aR,8R,9aS)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-4-sulfanylidenepyrimidin-2-one |
|---|---|
| PubChem CID | 175677702 |
| Molecular Formula | C21H38N2O5SSi2 |
| Molecular Weight | 486.78 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 1-[(6aR,8R,9aS)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-4-sulfanylidenepyrimidin-2-one |
| SMILES | CC(C)[Si]1(C(C)C)OC[C@H]2O[C@@H](n3ccc(=S)[nH]c3=O)C[C@@H]2O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C21H38N2O5SSi2/c1-13(2)30(14(3)4)25-12-18-17(27-31(28-30,15(5)6)16(7)8)11-20(26-18)23-10-9-19(29)22-21(23)24/h9-10,13-18,20H,11-12H2,1-8H3,(H,22,24,29)/t17-,18+,20+/m0/s1 |
| InChIKey | YJLBFRUQFBJUHX-NLWGTHIKSA-N |
| XLogP | 5.15 |
| TPSA | 74.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.78 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|