C22H40N2O7Si2 — CID 67978363
1-[(6aR,8R,9R)-9-(hydroxymethyl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]pyrimidine-2,4-dione (PubChem CID 67978363) has the molecular formula C22H40N2O7Si2 and a molecular weight of 500.74 g/mol. Its IUPAC name is 1-[(6aR,8R,9R)-9-(hydroxymethyl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(6aR,8R,9R)-9-(hydroxymethyl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 67978363 |
| Molecular Formula | C22H40N2O7Si2 |
| Molecular Weight | 500.74 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | 1-[(6aR,8R,9R)-9-(hydroxymethyl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]pyrimidine-2,4-dione |
| SMILES | CC(C)[Si]1(C(C)C)OC[C@H]2O[C@@H](n3ccc(=O)[nH]c3=O)[C@H](CO)C2O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C22H40N2O7Si2/c1-13(2)32(14(3)4)28-12-18-20(30-33(31-32,15(5)6)16(7)8)17(11-25)21(29-18)24-10-9-19(26)23-22(24)27/h9-10,13-18,20-21,25H,11-12H2,1-8H3,(H,23,26,27)/t17-,18-,20?,21-/m1/s1 |
| InChIKey | NYWAAMJZPLFRPX-IDCIOKQTSA-N |
| XLogP | 3.00 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.74 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|