C22H42N2O8Si2 — CID 10052330
1-[(1R)-2-hydroxy-1-[[(6R,7R)-6-(hydroxymethyl)-2,2,4,4-tetra(propan-2-yl)-1,3,5,2,4-trioxadisilocan-7-yl]oxy]ethyl]pyrimidine-2,4-dione (PubChem CID 10052330) has the molecular formula C22H42N2O8Si2 and a molecular weight of 518.76 g/mol. Its IUPAC name is 1-[(1R)-2-hydroxy-1-[[(6R,7R)-6-(hydroxymethyl)-2,2,4,4-tetra(propan-2-yl)-1,3,5,2,4-trioxadisilocan-7-yl]oxy]ethyl]pyrimidine-2,4-dione.
| Compound Name | 1-[(1R)-2-hydroxy-1-[[(6R,7R)-6-(hydroxymethyl)-2,2,4,4-tetra(propan-2-yl)-1,3,5,2,4-trioxadisilocan-7-yl]oxy]ethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10052330 |
| Molecular Formula | C22H42N2O8Si2 |
| Molecular Weight | 518.76 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | 1-[(1R)-2-hydroxy-1-[[(6R,7R)-6-(hydroxymethyl)-2,2,4,4-tetra(propan-2-yl)-1,3,5,2,4-trioxadisilocan-7-yl]oxy]ethyl]pyrimidine-2,4-dione |
| SMILES | CC(C)[Si]1(C(C)C)OC[C@@H](O[C@H](CO)n2ccc(=O)[nH]c2=O)[C@@H](CO)O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C22H42N2O8Si2/c1-14(2)33(15(3)4)29-13-19(18(11-25)31-34(32-33,16(5)6)17(7)8)30-21(12-26)24-10-9-20(27)23-22(24)28/h9-10,14-19,21,25-26H,11-13H2,1-8H3,(H,23,27,28)/t18-,19-,21-/m1/s1 |
| InChIKey | NYNAHPYGKFXTHN-SFHLNBCPSA-N |
| XLogP | 2.36 |
| TPSA | 132.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.76 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|