C22H37N3O6Si2 — CID 10480929
CID 10480929 (PubChem CID 10480929) has the molecular formula C22H37N3O6Si2 and a molecular weight of 495.73 g/mol.
| Compound Name | CID 10480929 |
|---|---|
| PubChem CID | 10480929 |
| Molecular Formula | C22H37N3O6Si2 |
| Molecular Weight | 495.73 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | — |
| SMILES | [C]=N[C@@H]1[C@@H]2O[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)OC[C@H]2O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C22H37N3O6Si2/c1-13(2)32(14(3)4)28-12-17-20(30-33(31-32,15(5)6)16(7)8)19(23-9)21(29-17)25-11-10-18(26)24-22(25)27/h10-11,13-17,19-21H,12H2,1-8H3,(H,24,26,27)/t17-,19-,20-,21-/m1/s1 |
| InChIKey | XKPRIOOQGXHDHW-CWJKEVGVSA-N |
| XLogP | 3.21 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.73 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|