C25H46N2O10SSi2 — CID 11273592
3-[(6aR,8R,9S,9aR)-8-(2,4-dioxopyrimidin-1-yl)-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-6,6a,8,9a-tetrahydrofuro[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl]propyl methanesulfonate (PubChem CID 11273592) has the molecular formula C25H46N2O10SSi2 and a molecular weight of 622.89 g/mol. Its IUPAC name is 3-[(6aR,8R,9S,9aR)-8-(2,4-dioxopyrimidin-1-yl)-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-6,6a,8,9a-tetrahydrofuro[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl]propyl methanesulfonate.
| Compound Name | 3-[(6aR,8R,9S,9aR)-8-(2,4-dioxopyrimidin-1-yl)-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-6,6a,8,9a-tetrahydrofuro[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl]propyl methanesulfonate |
|---|---|
| PubChem CID | 11273592 |
| Molecular Formula | C25H46N2O10SSi2 |
| Molecular Weight | 622.89 g/mol |
| Exact Mass | 622.24 |
| IUPAC Name | 3-[(6aR,8R,9S,9aR)-8-(2,4-dioxopyrimidin-1-yl)-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-6,6a,8,9a-tetrahydrofuro[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl]propyl methanesulfonate |
| SMILES | CC(C)[Si]1(C(C)C)OC[C@H]2O[C@@H](n3ccc(=O)[nH]c3=O)[C@](O)(CCCOS(C)(=O)=O)[C@@H]2O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C25H46N2O10SSi2/c1-16(2)39(17(3)4)34-15-20-22(36-40(37-39,18(5)6)19(7)8)25(30,12-10-14-33-38(9,31)32)23(35-20)27-13-11-21(28)26-24(27)29/h11,13,16-20,22-23,30H,10,12,14-15H2,1-9H3,(H,26,28,29)/t20-,22-,23-,25+/m1/s1 |
| InChIKey | IZPYAMNMXDULKO-QYOMTGNWSA-N |
| XLogP | 2.88 |
| TPSA | 155.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.89 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|