C30H52N2O10Si2 — CID 158570328
2-O-[(6aS,8R,9R,9aR)-2,2,4-tri(butan-2-yl)-4-butyl-8-(2,4-dioxopyrimidin-1-yl)-9-methyl-6,6a,8,9a-tetrahydrofuro[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl] 1-O-ethyl oxalate (PubChem CID 158570328) has the molecular formula C30H52N2O10Si2 and a molecular weight of 656.92 g/mol. Its IUPAC name is 2-O-[(6aS,8R,9R,9aR)-2,2,4-tri(butan-2-yl)-4-butyl-8-(2,4-dioxopyrimidin-1-yl)-9-methyl-6,6a,8,9a-tetrahydrofuro[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl] 1-O-ethyl oxalate.
| Compound Name | 2-O-[(6aS,8R,9R,9aR)-2,2,4-tri(butan-2-yl)-4-butyl-8-(2,4-dioxopyrimidin-1-yl)-9-methyl-6,6a,8,9a-tetrahydrofuro[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl] 1-O-ethyl oxalate |
|---|---|
| PubChem CID | 158570328 |
| Molecular Formula | C30H52N2O10Si2 |
| Molecular Weight | 656.92 g/mol |
| Exact Mass | 656.32 |
| IUPAC Name | 2-O-[(6aS,8R,9R,9aR)-2,2,4-tri(butan-2-yl)-4-butyl-8-(2,4-dioxopyrimidin-1-yl)-9-methyl-6,6a,8,9a-tetrahydrofuro[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl] 1-O-ethyl oxalate |
| SMILES | CCCC[Si]1(C(C)CC)OC[C@@H]2O[C@@H](n3ccc(=O)[nH]c3=O)[C@](C)(OC(=O)C(=O)OCC)[C@@H]2O[Si](C(C)CC)(C(C)CC)O1 |
| InChI | InChI=1S/C30H52N2O10Si2/c1-10-15-18-43(20(6)11-2)38-19-23-25(41-44(42-43,21(7)12-3)22(8)13-4)30(9,40-27(35)26(34)37-14-5)28(39-23)32-17-16-24(33)31-29(32)36/h16-17,20-23,25,28H,10-15,18-19H2,1-9H3,(H,31,33,36)/t20?,21?,22?,23-,25+,28+,30+,43?,44?/m0/s1 |
| InChIKey | HRZOTMAOLUVCCJ-KZLNCTJSSA-N |
| XLogP | 4.82 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.92 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|