C27H48N2O6Si3 — CID 140699162
1-[(6aR,8R,9R,9aR)-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-9-(2-trimethylsilylethynyl)-6a,7,8,9a-tetrahydro-6H-cyclopenta[f][1,3,5,2,4]trioxadisilocin-8-yl]pyrimidine-2,4-dione (PubChem CID 140699162) has the molecular formula C27H48N2O6Si3 and a molecular weight of 580.95 g/mol. Its IUPAC name is 1-[(6aR,8R,9R,9aR)-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-9-(2-trimethylsilylethynyl)-6a,7,8,9a-tetrahydro-6H-cyclopenta[f][1,3,5,2,4]trioxadisilocin-8-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(6aR,8R,9R,9aR)-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-9-(2-trimethylsilylethynyl)-6a,7,8,9a-tetrahydro-6H-cyclopenta[f][1,3,5,2,4]trioxadisilocin-8-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 140699162 |
| Molecular Formula | C27H48N2O6Si3 |
| Molecular Weight | 580.95 g/mol |
| Exact Mass | 580.28 |
| IUPAC Name | 1-[(6aR,8R,9R,9aR)-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-9-(2-trimethylsilylethynyl)-6a,7,8,9a-tetrahydro-6H-cyclopenta[f][1,3,5,2,4]trioxadisilocin-8-yl]pyrimidine-2,4-dione |
| SMILES | CC(C)[Si]1(C(C)C)OC[C@H]2C[C@@H](n3ccc(=O)[nH]c3=O)[C@](O)(C#C[Si](C)(C)C)[C@@H]2O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C27H48N2O6Si3/c1-18(2)37(19(3)4)33-17-22-16-23(29-14-12-24(30)28-26(29)31)27(32,13-15-36(9,10)11)25(22)34-38(35-37,20(5)6)21(7)8/h12,14,18-23,25,32H,16-17H2,1-11H3,(H,28,30,31)/t22-,23-,25-,27-/m1/s1 |
| InChIKey | CYXGMBHBGKYLAT-JTOATPROSA-N |
| XLogP | 4.67 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.95 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|