C23H39N3O7Si2 — CID 70907701
(6aR,8R,9R,9aR)-8-(2,4-dioxopyrimidin-1-yl)-9-hydroxy-9-methyl-2,2,4,4-tetra(propan-2-yl)-6a,9a-dihydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocine-8-carbonitrile (PubChem CID 70907701) has the molecular formula C23H39N3O7Si2 and a molecular weight of 525.75 g/mol. Its IUPAC name is (6aR,8R,9R,9aR)-8-(2,4-dioxopyrimidin-1-yl)-9-hydroxy-9-methyl-2,2,4,4-tetra(propan-2-yl)-6a,9a-dihydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocine-8-carbonitrile.
| Compound Name | (6aR,8R,9R,9aR)-8-(2,4-dioxopyrimidin-1-yl)-9-hydroxy-9-methyl-2,2,4,4-tetra(propan-2-yl)-6a,9a-dihydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocine-8-carbonitrile |
|---|---|
| PubChem CID | 70907701 |
| Molecular Formula | C23H39N3O7Si2 |
| Molecular Weight | 525.75 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | (6aR,8R,9R,9aR)-8-(2,4-dioxopyrimidin-1-yl)-9-hydroxy-9-methyl-2,2,4,4-tetra(propan-2-yl)-6a,9a-dihydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocine-8-carbonitrile |
| SMILES | CC(C)[Si]1(C(C)C)OC[C@H]2O[C@@](C#N)(n3ccc(=O)[nH]c3=O)[C@](C)(O)[C@@H]2O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C23H39N3O7Si2/c1-14(2)34(15(3)4)30-12-18-20(32-35(33-34,16(5)6)17(7)8)22(9,29)23(13-24,31-18)26-11-10-19(27)25-21(26)28/h10-11,14-18,20,29H,12H2,1-9H3,(H,25,27,28)/t18-,20-,22-,23-/m1/s1 |
| InChIKey | VQBIHLQCEOGWCZ-KPUOSGPGSA-N |
| XLogP | 2.82 |
| TPSA | 135.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.75 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|