C23H39FN2O8Si2 — CID 102594995
[(6aR,8S,9S,9aR)-8-(2,4-dioxopyrimidin-1-yl)-8-fluoro-2,2,4,4-tetra(propan-2-yl)-6,6a,9,9a-tetrahydrofuro[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl] acetate (PubChem CID 102594995) has the molecular formula C23H39FN2O8Si2 and a molecular weight of 546.74 g/mol. Its IUPAC name is [(6aR,8S,9S,9aR)-8-(2,4-dioxopyrimidin-1-yl)-8-fluoro-2,2,4,4-tetra(propan-2-yl)-6,6a,9,9a-tetrahydrofuro[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl] acetate.
| Compound Name | [(6aR,8S,9S,9aR)-8-(2,4-dioxopyrimidin-1-yl)-8-fluoro-2,2,4,4-tetra(propan-2-yl)-6,6a,9,9a-tetrahydrofuro[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl] acetate |
|---|---|
| PubChem CID | 102594995 |
| Molecular Formula | C23H39FN2O8Si2 |
| Molecular Weight | 546.74 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | [(6aR,8S,9S,9aR)-8-(2,4-dioxopyrimidin-1-yl)-8-fluoro-2,2,4,4-tetra(propan-2-yl)-6,6a,9,9a-tetrahydrofuro[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H]2O[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)OC[C@H]2O[C@@]1(F)n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C23H39FN2O8Si2/c1-13(2)35(14(3)4)30-12-18-20(33-36(34-35,15(5)6)16(7)8)21(31-17(9)27)23(24,32-18)26-11-10-19(28)25-22(26)29/h10-11,13-16,18,20-21H,12H2,1-9H3,(H,25,28,29)/t18-,20-,21+,23+/m1/s1 |
| InChIKey | WHQXACBGEWGBCO-WQJYWUQFSA-N |
| XLogP | 3.40 |
| TPSA | 118.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.74 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|