C26H45N3O9S2Si2 — CID 59253589
O-[(6aR,8R,9aS)-8-(2,4-dioxopyrimidin-1-yl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl] 1,1-dioxo-1,4-thiazinane-4-carbothioate (PubChem CID 59253589) has the molecular formula C26H45N3O9S2Si2 and a molecular weight of 663.96 g/mol. Its IUPAC name is O-[(6aR,8R,9aS)-8-(2,4-dioxopyrimidin-1-yl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl] 1,1-dioxo-1,4-thiazinane-4-carbothioate.
| Compound Name | O-[(6aR,8R,9aS)-8-(2,4-dioxopyrimidin-1-yl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl] 1,1-dioxo-1,4-thiazinane-4-carbothioate |
|---|---|
| PubChem CID | 59253589 |
| Molecular Formula | C26H45N3O9S2Si2 |
| Molecular Weight | 663.96 g/mol |
| Exact Mass | 663.21 |
| IUPAC Name | O-[(6aR,8R,9aS)-8-(2,4-dioxopyrimidin-1-yl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl] 1,1-dioxo-1,4-thiazinane-4-carbothioate |
| SMILES | CC(C)[Si]1(C(C)C)OC[C@H]2O[C@@H](n3ccc(=O)[nH]c3=O)C(OC(=S)N3CCS(=O)(=O)CC3)[C@H]2O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C26H45N3O9S2Si2/c1-16(2)41(17(3)4)34-15-20-22(37-42(38-41,18(5)6)19(7)8)23(24(35-20)29-10-9-21(30)27-25(29)31)36-26(39)28-11-13-40(32,33)14-12-28/h9-10,16-20,22-24H,11-15H2,1-8H3,(H,27,30,31)/t20-,22+,23?,24-/m1/s1 |
| InChIKey | YTPIDKBRJUSUSE-LZJDEXAUSA-N |
| XLogP | 2.79 |
| TPSA | 138.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.96 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|