C14H19N3O8S2 — CID 54672592
O-[(2R,3R,4R,5R)-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] 1,1-dioxo-1,4-thiazinane-4-carbothioate (PubChem CID 54672592) has the molecular formula C14H19N3O8S2 and a molecular weight of 421.45 g/mol. Its IUPAC name is O-[(2R,3R,4R,5R)-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] 1,1-dioxo-1,4-thiazinane-4-carbothioate.
| Compound Name | O-[(2R,3R,4R,5R)-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] 1,1-dioxo-1,4-thiazinane-4-carbothioate |
|---|---|
| PubChem CID | 54672592 |
| Molecular Formula | C14H19N3O8S2 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | O-[(2R,3R,4R,5R)-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] 1,1-dioxo-1,4-thiazinane-4-carbothioate |
| SMILES | O=c1ccn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2OC(=S)N2CCS(=O)(=O)CC2)c(=O)[nH]1 |
| InChI | InChI=1S/C14H19N3O8S2/c18-7-8-10(20)11(12(24-8)17-2-1-9(19)15-13(17)21)25-14(26)16-3-5-27(22,23)6-4-16/h1-2,8,10-12,18,20H,3-7H2,(H,15,19,21)/t8-,10-,11-,12-/m1/s1 |
| InChIKey | FHNZIBQDCMULOI-HJQYOEGKSA-N |
| XLogP | -2.81 |
| TPSA | 151.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|