C29H44N2O8SSi2 — CID 23257391
1-[(6aS,8R,9R,9aS)-9-phenoxycarbothioyloxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 23257391) has the molecular formula C29H44N2O8SSi2 and a molecular weight of 636.92 g/mol. Its IUPAC name is 1-[(6aS,8R,9R,9aS)-9-phenoxycarbothioyloxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(6aS,8R,9R,9aS)-9-phenoxycarbothioyloxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 23257391 |
| Molecular Formula | C29H44N2O8SSi2 |
| Molecular Weight | 636.92 g/mol |
| Exact Mass | 636.24 |
| IUPAC Name | 1-[(6aS,8R,9R,9aS)-9-phenoxycarbothioyloxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@@H]2O[C@H]3CO[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)O[C@@H]3[C@H]2OC(=S)Oc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C29H44N2O8SSi2/c1-17(2)41(18(3)4)34-16-23-24(38-42(39-41,19(5)6)20(7)8)25(37-29(40)35-22-13-11-10-12-14-22)27(36-23)31-15-21(9)26(32)30-28(31)33/h10-15,17-20,23-25,27H,16H2,1-9H3,(H,30,32,33)/t23-,24-,25+,27+/m0/s1 |
| InChIKey | NZXQDQFAWNYCOB-AGBXIKQOSA-N |
| XLogP | 5.45 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.92 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|