C30H47O9PSi2 — CID 11125086
[(6aR,8S,9R,9aR)-8-methoxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl] diphenyl phosphate (PubChem CID 11125086) has the molecular formula C30H47O9PSi2 and a molecular weight of 638.84 g/mol. Its IUPAC name is [(6aR,8S,9R,9aR)-8-methoxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl] diphenyl phosphate.
| Compound Name | [(6aR,8S,9R,9aR)-8-methoxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl] diphenyl phosphate |
|---|---|
| PubChem CID | 11125086 |
| Molecular Formula | C30H47O9PSi2 |
| Molecular Weight | 638.84 g/mol |
| Exact Mass | 638.25 |
| IUPAC Name | [(6aR,8S,9R,9aR)-8-methoxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl] diphenyl phosphate |
| SMILES | CO[C@H]1O[C@@H]2CO[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)O[C@H]2[C@H]1OP(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C30H47O9PSi2/c1-21(2)41(22(3)4)33-20-27-28(38-42(39-41,23(5)6)24(7)8)29(30(32-9)34-27)37-40(31,35-25-16-12-10-13-17-25)36-26-18-14-11-15-19-26/h10-19,21-24,27-30H,20H2,1-9H3/t27-,28-,29-,30+/m1/s1 |
| InChIKey | KSZPVCWUIRPMBC-CSBHBGLHSA-N |
| XLogP | 7.97 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.84 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|