C30H47O6PSi2 — CID 10769739
[(6aR,8R,9R,9aR)-8-methoxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl]oxy-diphenylphosphane (PubChem CID 10769739) has the molecular formula C30H47O6PSi2 and a molecular weight of 590.85 g/mol. Its IUPAC name is [(6aR,8R,9R,9aR)-8-methoxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl]oxy-diphenylphosphane.
| Compound Name | [(6aR,8R,9R,9aR)-8-methoxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl]oxy-diphenylphosphane |
|---|---|
| PubChem CID | 10769739 |
| Molecular Formula | C30H47O6PSi2 |
| Molecular Weight | 590.85 g/mol |
| Exact Mass | 590.26 |
| IUPAC Name | [(6aR,8R,9R,9aR)-8-methoxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl]oxy-diphenylphosphane |
| SMILES | CO[C@@H]1O[C@@H]2CO[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)O[C@H]2[C@H]1OP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H47O6PSi2/c1-21(2)38(22(3)4)32-20-27-28(35-39(36-38,23(5)6)24(7)8)29(30(31-9)33-27)34-37(25-16-12-10-13-17-25)26-18-14-11-15-19-26/h10-19,21-24,27-30H,20H2,1-9H3/t27-,28-,29-,30-/m1/s1 |
| InChIKey | GTBNJQUGSVHSKC-SKKKGAJSSA-N |
| XLogP | 6.75 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.85 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|