C26H43NO6Si2 — CID 167492254
(6aR,8R,9R,10R,10aS)-8-indol-1-yl-2,2,4,4-tetra(propan-2-yl)-6,6a,8,9,10,10a-hexahydropyrano[3,2-f][1,3,5,2,4]trioxadisilocine-9,10-diol (PubChem CID 167492254) has the molecular formula C26H43NO6Si2 and a molecular weight of 521.80 g/mol. Its IUPAC name is (6aR,8R,9R,10R,10aS)-8-indol-1-yl-2,2,4,4-tetra(propan-2-yl)-6,6a,8,9,10,10a-hexahydropyrano[3,2-f][1,3,5,2,4]trioxadisilocine-9,10-diol.
| Compound Name | (6aR,8R,9R,10R,10aS)-8-indol-1-yl-2,2,4,4-tetra(propan-2-yl)-6,6a,8,9,10,10a-hexahydropyrano[3,2-f][1,3,5,2,4]trioxadisilocine-9,10-diol |
|---|---|
| PubChem CID | 167492254 |
| Molecular Formula | C26H43NO6Si2 |
| Molecular Weight | 521.80 g/mol |
| Exact Mass | 521.26 |
| IUPAC Name | (6aR,8R,9R,10R,10aS)-8-indol-1-yl-2,2,4,4-tetra(propan-2-yl)-6,6a,8,9,10,10a-hexahydropyrano[3,2-f][1,3,5,2,4]trioxadisilocine-9,10-diol |
| SMILES | CC(C)[Si]1(C(C)C)OC[C@H]2O[C@@H](n3ccc4ccccc43)[C@H](O)[C@@H](O)[C@@H]2O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C26H43NO6Si2/c1-16(2)34(17(3)4)30-15-22-25(32-35(33-34,18(5)6)19(7)8)23(28)24(29)26(31-22)27-14-13-20-11-9-10-12-21(20)27/h9-14,16-19,22-26,28-29H,15H2,1-8H3/t22-,23-,24-,25-,26-/m1/s1 |
| InChIKey | UBJWXZCLXMRFTJ-ZFXZZAOISA-N |
| XLogP | 5.22 |
| TPSA | 82.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.80 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|