C21H38N2O7Si2 — CID 177125384
3-[(6aR,8R,9S,9aS)-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-1H-pyrimidine-2,4-dione (PubChem CID 177125384) has the molecular formula C21H38N2O7Si2 and a molecular weight of 486.71 g/mol. Its IUPAC name is 3-[(6aR,8R,9S,9aS)-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-1H-pyrimidine-2,4-dione.
| Compound Name | 3-[(6aR,8R,9S,9aS)-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 177125384 |
| Molecular Formula | C21H38N2O7Si2 |
| Molecular Weight | 486.71 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | 3-[(6aR,8R,9S,9aS)-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-1H-pyrimidine-2,4-dione |
| SMILES | CC(C)[Si]1(C(C)C)OC[C@H]2O[C@@H](n3c(=O)cc[nH]c3=O)[C@@H](O)[C@@H]2O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C21H38N2O7Si2/c1-12(2)31(13(3)4)27-11-16-19(29-32(30-31,14(5)6)15(7)8)18(25)20(28-16)23-17(24)9-10-22-21(23)26/h9-10,12-16,18-20,25H,11H2,1-8H3,(H,22,26)/t16-,18+,19-,20-/m1/s1 |
| InChIKey | PFNANWVEQKDTRU-GSEOLPGOSA-N |
| XLogP | 2.75 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.71 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|