C29H46N2O8Si2 — CID 14887266
1-[(6aR,8R,9R,9aS)-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-3-[(4-methoxyphenyl)methyl]pyrimidine-2,4-dione (PubChem CID 14887266) has the molecular formula C29H46N2O8Si2 and a molecular weight of 606.87 g/mol. Its IUPAC name is 1-[(6aR,8R,9R,9aS)-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-3-[(4-methoxyphenyl)methyl]pyrimidine-2,4-dione.
| Compound Name | 1-[(6aR,8R,9R,9aS)-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-3-[(4-methoxyphenyl)methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 14887266 |
| Molecular Formula | C29H46N2O8Si2 |
| Molecular Weight | 606.87 g/mol |
| Exact Mass | 606.28 |
| IUPAC Name | 1-[(6aR,8R,9R,9aS)-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-3-[(4-methoxyphenyl)methyl]pyrimidine-2,4-dione |
| SMILES | COc1ccc(Cn2c(=O)ccn([C@@H]3O[C@@H]4CO[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)O[C@H]4[C@H]3O)c2=O)cc1 |
| InChI | InChI=1S/C29H46N2O8Si2/c1-18(2)40(19(3)4)36-17-24-27(38-41(39-40,20(5)6)21(7)8)26(33)28(37-24)30-15-14-25(32)31(29(30)34)16-22-10-12-23(35-9)13-11-22/h10-15,18-21,24,26-28,33H,16-17H2,1-9H3/t24-,26-,27-,28-/m1/s1 |
| InChIKey | FRPWQEDUJGVGCG-YULOIDQLSA-N |
| XLogP | 4.28 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.87 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|