C21H36ClN3O8Si2 — CID 15404744
1-[(6aR,8R,9S,9aR)-9-chloro-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-3-nitropyrimidine-2,4-dione (PubChem CID 15404744) has the molecular formula C21H36ClN3O8Si2 and a molecular weight of 550.16 g/mol. Its IUPAC name is 1-[(6aR,8R,9S,9aR)-9-chloro-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-3-nitropyrimidine-2,4-dione.
| Compound Name | 1-[(6aR,8R,9S,9aR)-9-chloro-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-3-nitropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 15404744 |
| Molecular Formula | C21H36ClN3O8Si2 |
| Molecular Weight | 550.16 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | 1-[(6aR,8R,9S,9aR)-9-chloro-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-3-nitropyrimidine-2,4-dione |
| SMILES | CC(C)[Si]1(C(C)C)OC[C@H]2O[C@@H](n3ccc(=O)n([N+](=O)[O-])c3=O)[C@@H](Cl)[C@@H]2O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C21H36ClN3O8Si2/c1-12(2)34(13(3)4)30-11-16-19(32-35(33-34,14(5)6)15(7)8)18(22)20(31-16)23-10-9-17(26)24(21(23)27)25(28)29/h9-10,12-16,18-20H,11H2,1-8H3/t16-,18+,19-,20-/m1/s1 |
| InChIKey | VPEITTBQBLOYLF-GSEOLPGOSA-N |
| XLogP | 3.51 |
| TPSA | 124.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.16 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|