C19H38O5Si2 — CID 132580615
(6aR,8R,9S,9aS)-8-ethenyl-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-ol (PubChem CID 132580615) has the molecular formula C19H38O5Si2 and a molecular weight of 402.68 g/mol. Its IUPAC name is (6aR,8R,9S,9aS)-8-ethenyl-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-ol.
| Compound Name | (6aR,8R,9S,9aS)-8-ethenyl-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-ol |
|---|---|
| PubChem CID | 132580615 |
| Molecular Formula | C19H38O5Si2 |
| Molecular Weight | 402.68 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | (6aR,8R,9S,9aS)-8-ethenyl-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-ol |
| SMILES | C=C[C@H]1O[C@@H]2CO[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)O[C@H]2[C@H]1O |
| InChI | InChI=1S/C19H38O5Si2/c1-10-16-18(20)19-17(22-16)11-21-25(12(2)3,13(4)5)24-26(23-19,14(6)7)15(8)9/h10,12-20H,1,11H2,2-9H3/t16-,17-,18+,19-/m1/s1 |
| InChIKey | UHBUSGJUSQIYAS-AKHDSKFASA-N |
| XLogP | 4.26 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.68 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|