C19H40O7Si2 — CID 10972165
(6aR,8S,9R,10R,10aS)-8-methoxy-2,2,4,4-tetra(propan-2-yl)-6,6a,8,9,10,10a-hexahydropyrano[3,2-f][1,3,5,2,4]trioxadisilocine-9,10-diol (PubChem CID 10972165) has the molecular formula C19H40O7Si2 and a molecular weight of 436.69 g/mol. Its IUPAC name is (6aR,8S,9R,10R,10aS)-8-methoxy-2,2,4,4-tetra(propan-2-yl)-6,6a,8,9,10,10a-hexahydropyrano[3,2-f][1,3,5,2,4]trioxadisilocine-9,10-diol.
| Compound Name | (6aR,8S,9R,10R,10aS)-8-methoxy-2,2,4,4-tetra(propan-2-yl)-6,6a,8,9,10,10a-hexahydropyrano[3,2-f][1,3,5,2,4]trioxadisilocine-9,10-diol |
|---|---|
| PubChem CID | 10972165 |
| Molecular Formula | C19H40O7Si2 |
| Molecular Weight | 436.69 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | (6aR,8S,9R,10R,10aS)-8-methoxy-2,2,4,4-tetra(propan-2-yl)-6,6a,8,9,10,10a-hexahydropyrano[3,2-f][1,3,5,2,4]trioxadisilocine-9,10-diol |
| SMILES | CO[C@H]1O[C@@H]2CO[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)O[C@H]2[C@H](O)[C@H]1O |
| InChI | InChI=1S/C19H40O7Si2/c1-11(2)27(12(3)4)23-10-15-18(16(20)17(21)19(22-9)24-15)25-28(26-27,13(5)6)14(7)8/h11-21H,10H2,1-9H3/t15-,16-,17-,18-,19+/m1/s1 |
| InChIKey | ZDJWUBKMQQAWOE-NNIGNNQHSA-N |
| XLogP | 3.04 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.69 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|