C23H42N2O5SSi2 — CID 11409709
1-[(6aR,8R,9S,9aS)-9-methyl-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-thieno[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 11409709) has the molecular formula C23H42N2O5SSi2 and a molecular weight of 514.84 g/mol. Its IUPAC name is 1-[(6aR,8R,9S,9aS)-9-methyl-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-thieno[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(6aR,8R,9S,9aS)-9-methyl-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-thieno[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11409709 |
| Molecular Formula | C23H42N2O5SSi2 |
| Molecular Weight | 514.84 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | 1-[(6aR,8R,9S,9aS)-9-methyl-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-thieno[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@@H]2S[C@@H]3CO[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)O[C@H]3[C@@H]2C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H42N2O5SSi2/c1-13(2)32(14(3)4)28-12-19-20(29-33(30-32,15(5)6)16(7)8)18(10)22(31-19)25-11-17(9)21(26)24-23(25)27/h11,13-16,18-20,22H,12H2,1-10H3,(H,24,26,27)/t18-,19+,20-,22+/m0/s1 |
| InChIKey | JURSBISNIQMBAX-CUXKYVRBSA-N |
| XLogP | 5.05 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.84 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|