C23H42N2O5Si2 — CID 58445191
1-[(6aR)-2,2,4,4-tetra(propan-2-yl)-6,6a,7,8,9,9a-hexahydrocyclopenta[f][1,3,5,2,4]trioxadisilocin-8-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 58445191) has the molecular formula C23H42N2O5Si2 and a molecular weight of 482.77 g/mol. Its IUPAC name is 1-[(6aR)-2,2,4,4-tetra(propan-2-yl)-6,6a,7,8,9,9a-hexahydrocyclopenta[f][1,3,5,2,4]trioxadisilocin-8-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(6aR)-2,2,4,4-tetra(propan-2-yl)-6,6a,7,8,9,9a-hexahydrocyclopenta[f][1,3,5,2,4]trioxadisilocin-8-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 58445191 |
| Molecular Formula | C23H42N2O5Si2 |
| Molecular Weight | 482.77 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | 1-[(6aR)-2,2,4,4-tetra(propan-2-yl)-6,6a,7,8,9,9a-hexahydrocyclopenta[f][1,3,5,2,4]trioxadisilocin-8-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn(C2CC3O[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)OC[C@H]3C2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H42N2O5Si2/c1-14(2)31(15(3)4)28-13-19-10-20(25-12-18(9)22(26)24-23(25)27)11-21(19)29-32(30-31,16(5)6)17(7)8/h12,14-17,19-21H,10-11,13H2,1-9H3,(H,24,26,27)/t19-,20?,21?/m1/s1 |
| InChIKey | ZCDNYSSXOOLXOV-QNGMFEMESA-N |
| XLogP | 4.75 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.77 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|