C25H41N3O7Si2 — CID 174097838
1-[(1R,12R,14R)-12-ethynyl-4,4,6,6-tetra(propan-2-yl)-3,5,7,10,13-pentaoxa-11-aza-4,6-disilatricyclo[7.3.2.01,8]tetradecan-14-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 174097838) has the molecular formula C25H41N3O7Si2 and a molecular weight of 551.79 g/mol. Its IUPAC name is 1-[(1R,12R,14R)-12-ethynyl-4,4,6,6-tetra(propan-2-yl)-3,5,7,10,13-pentaoxa-11-aza-4,6-disilatricyclo[7.3.2.01,8]tetradecan-14-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(1R,12R,14R)-12-ethynyl-4,4,6,6-tetra(propan-2-yl)-3,5,7,10,13-pentaoxa-11-aza-4,6-disilatricyclo[7.3.2.01,8]tetradecan-14-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 174097838 |
| Molecular Formula | C25H41N3O7Si2 |
| Molecular Weight | 551.79 g/mol |
| Exact Mass | 551.25 |
| IUPAC Name | 1-[(1R,12R,14R)-12-ethynyl-4,4,6,6-tetra(propan-2-yl)-3,5,7,10,13-pentaoxa-11-aza-4,6-disilatricyclo[7.3.2.01,8]tetradecan-14-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | C#C[C@H]1NOC2C3O[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)OC[C@@]31O[C@H]2n1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C25H41N3O7Si2/c1-11-19-25-13-31-36(14(2)3,15(4)5)35-37(16(6)7,17(8)9)34-21(25)20(33-27-19)23(32-25)28-12-18(10)22(29)26-24(28)30/h1,12,14-17,19-21,23,27H,13H2,2-10H3,(H,26,29,30)/t19-,20?,21?,23-,25+/m1/s1 |
| InChIKey | RULVDDYCZDETDS-VPPSPBCXSA-N |
| XLogP | 2.97 |
| TPSA | 113.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.79 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|