C18H24N2O6 — CID 58173996
(4R,6R,6aS)-4-ethyl-6-(5-methyl-2,4-dioxopyrimidin-1-yl)spiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-2,1'-cyclohexane]-4-carbaldehyde (PubChem CID 58173996) has the molecular formula C18H24N2O6 and a molecular weight of 364.40 g/mol. Its IUPAC name is (4R,6R,6aS)-4-ethyl-6-(5-methyl-2,4-dioxopyrimidin-1-yl)spiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-2,1'-cyclohexane]-4-carbaldehyde.
| Compound Name | (4R,6R,6aS)-4-ethyl-6-(5-methyl-2,4-dioxopyrimidin-1-yl)spiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-2,1'-cyclohexane]-4-carbaldehyde |
|---|---|
| PubChem CID | 58173996 |
| Molecular Formula | C18H24N2O6 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | (4R,6R,6aS)-4-ethyl-6-(5-methyl-2,4-dioxopyrimidin-1-yl)spiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-2,1'-cyclohexane]-4-carbaldehyde |
| SMILES | CC[C@@]1(C=O)O[C@@H](n2cc(C)c(=O)[nH]c2=O)[C@H]2OC3(CCCCC3)OC21 |
| InChI | InChI=1S/C18H24N2O6/c1-3-17(10-21)13-12(24-18(25-13)7-5-4-6-8-18)15(26-17)20-9-11(2)14(22)19-16(20)23/h9-10,12-13,15H,3-8H2,1-2H3,(H,19,22,23)/t12-,13?,15+,17-/m0/s1 |
| InChIKey | OCQGLQQTLNYBNH-HQJRDCNGSA-N |
| XLogP | 1.17 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|