C17H20N2O5 — CID 118012965
1-[(3aS,4S,6R,6aR)-4-ethyl-4-ethynylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-2,1'-cyclopentane]-6-yl]pyrimidine-2,4-dione (PubChem CID 118012965) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is 1-[(3aS,4S,6R,6aR)-4-ethyl-4-ethynylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-2,1'-cyclopentane]-6-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(3aS,4S,6R,6aR)-4-ethyl-4-ethynylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-2,1'-cyclopentane]-6-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 118012965 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 1-[(3aS,4S,6R,6aR)-4-ethyl-4-ethynylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-2,1'-cyclopentane]-6-yl]pyrimidine-2,4-dione |
| SMILES | C#C[C@]1(CC)O[C@@H](n2ccc(=O)[nH]c2=O)[C@@H]2OC3(CCCC3)O[C@@H]21 |
| InChI | InChI=1S/C17H20N2O5/c1-3-16(4-2)13-12(22-17(23-13)8-5-6-9-17)14(24-16)19-10-7-11(20)18-15(19)21/h1,7,10,12-14H,4-6,8-9H2,2H3,(H,18,20,21)/t12-,13+,14-,16-/m1/s1 |
| InChIKey | SYNXEHMYJNVVQH-HLPPOEQASA-N |
| XLogP | 0.90 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|