C17H20N2O6 — CID 170257906
1-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-3a-prop-1-ynylspiro[6,6a-dihydro-4H-furo[3,4-d][1,3]dioxole-2,1'-cyclopentane]-4-yl]pyrimidine-2,4-dione (PubChem CID 170257906) has the molecular formula C17H20N2O6 and a molecular weight of 348.36 g/mol. Its IUPAC name is 1-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-3a-prop-1-ynylspiro[6,6a-dihydro-4H-furo[3,4-d][1,3]dioxole-2,1'-cyclopentane]-4-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-3a-prop-1-ynylspiro[6,6a-dihydro-4H-furo[3,4-d][1,3]dioxole-2,1'-cyclopentane]-4-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 170257906 |
| Molecular Formula | C17H20N2O6 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 1-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-3a-prop-1-ynylspiro[6,6a-dihydro-4H-furo[3,4-d][1,3]dioxole-2,1'-cyclopentane]-4-yl]pyrimidine-2,4-dione |
| SMILES | CC#C[C@@]12OC3(CCCC3)O[C@@H]1[C@@H](CO)O[C@H]2n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C17H20N2O6/c1-2-6-17-13(24-16(25-17)7-3-4-8-16)11(10-20)23-14(17)19-9-5-12(21)18-15(19)22/h5,9,11,13-14,20H,3-4,7-8,10H2,1H3,(H,18,21,22)/t11-,13-,14-,17-/m1/s1 |
| InChIKey | BNVVYNQDYUIZCT-LSCFUAHRSA-N |
| XLogP | -0.13 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|