C17H19IN2O5 — CID 90248196
1-[(3aR,4R,6S,6aR)-6-(iodomethyl)-3a-propa-1,2-dienylspiro[6,6a-dihydro-4H-furo[3,4-d][1,3]dioxole-2,1'-cyclopentane]-4-yl]pyrimidine-2,4-dione (PubChem CID 90248196) has the molecular formula C17H19IN2O5 and a molecular weight of 458.25 g/mol. Its IUPAC name is 1-[(3aR,4R,6S,6aR)-6-(iodomethyl)-3a-propa-1,2-dienylspiro[6,6a-dihydro-4H-furo[3,4-d][1,3]dioxole-2,1'-cyclopentane]-4-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(3aR,4R,6S,6aR)-6-(iodomethyl)-3a-propa-1,2-dienylspiro[6,6a-dihydro-4H-furo[3,4-d][1,3]dioxole-2,1'-cyclopentane]-4-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 90248196 |
| Molecular Formula | C17H19IN2O5 |
| Molecular Weight | 458.25 g/mol |
| Exact Mass | 458.03 |
| IUPAC Name | 1-[(3aR,4R,6S,6aR)-6-(iodomethyl)-3a-propa-1,2-dienylspiro[6,6a-dihydro-4H-furo[3,4-d][1,3]dioxole-2,1'-cyclopentane]-4-yl]pyrimidine-2,4-dione |
| SMILES | C=C=C[C@@]12OC3(CCCC3)O[C@@H]1[C@@H](CI)O[C@H]2n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C17H19IN2O5/c1-2-6-17-13(24-16(25-17)7-3-4-8-16)11(10-18)23-14(17)20-9-5-12(21)19-15(20)22/h5-6,9,11,13-14H,1,3-4,7-8,10H2,(H,19,21,22)/t11-,13-,14-,17-/m1/s1 |
| InChIKey | SQKZBSWBYPOLPO-LSCFUAHRSA-N |
| XLogP | 1.63 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|