C17H22N2O5 — CID 123460580
1-[5-ethyl-3-ethynyl-3-(1-hydroxycyclopentyl)oxyoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 123460580) has the molecular formula C17H22N2O5 and a molecular weight of 334.37 g/mol. Its IUPAC name is 1-[5-ethyl-3-ethynyl-3-(1-hydroxycyclopentyl)oxyoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[5-ethyl-3-ethynyl-3-(1-hydroxycyclopentyl)oxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 123460580 |
| Molecular Formula | C17H22N2O5 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 1-[5-ethyl-3-ethynyl-3-(1-hydroxycyclopentyl)oxyoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C#CC1(OC2(O)CCCC2)CC(CC)OC1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C17H22N2O5/c1-3-12-11-16(4-2,24-17(22)8-5-6-9-17)14(23-12)19-10-7-13(20)18-15(19)21/h2,7,10,12,14,22H,3,5-6,8-9,11H2,1H3,(H,18,20,21) |
| InChIKey | IPGKWJWQJXTJBX-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|