C11H16N2O8P+ — CID 123529218
[2-[5-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-4-methyloxolan-2-yl]-2-oxoethyl]-trihydroxyphosphanium (PubChem CID 123529218) has the molecular formula C11H16N2O8P+ and a molecular weight of 335.23 g/mol. Its IUPAC name is [2-[5-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-4-methyloxolan-2-yl]-2-oxoethyl]-trihydroxyphosphanium.
| Compound Name | [2-[5-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-4-methyloxolan-2-yl]-2-oxoethyl]-trihydroxyphosphanium |
|---|---|
| PubChem CID | 123529218 |
| Molecular Formula | C11H16N2O8P+ |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | [2-[5-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-4-methyloxolan-2-yl]-2-oxoethyl]-trihydroxyphosphanium |
| SMILES | CC1(O)CC(C(=O)C[P+](O)(O)O)OC1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C11H15N2O8P/c1-11(17)4-7(6(14)5-22(18,19)20)21-9(11)13-3-2-8(15)12-10(13)16/h2-3,7,9,17-20H,4-5H2,1H3/p+1 |
| InChIKey | JRWBCXNFYIXVFG-UHFFFAOYSA-O |
| XLogP | -2.12 |
| TPSA | 162.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|