C10H14N2O4 — CID 135134474
1-[(2R,3R,5S)-5-ethyl-3-hydroxyoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 135134474) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is 1-[(2R,3R,5S)-5-ethyl-3-hydroxyoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,5S)-5-ethyl-3-hydroxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135134474 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 1-[(2R,3R,5S)-5-ethyl-3-hydroxyoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CC[C@H]1C[C@@H](O)[C@H](n2ccc(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C10H14N2O4/c1-2-6-5-7(13)9(16-6)12-4-3-8(14)11-10(12)15/h3-4,6-7,9,13H,2,5H2,1H3,(H,11,14,15)/t6-,7+,9+/m0/s1 |
| InChIKey | CAOOQHDAJVNYPV-LKEWCRSYSA-N |
| XLogP | -0.41 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |