C15H20N2O4 — CID 143809470
1-[(3S,5R)-3-butyl-5-ethynyl-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 143809470) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is 1-[(3S,5R)-3-butyl-5-ethynyl-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(3S,5R)-3-butyl-5-ethynyl-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 143809470 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 1-[(3S,5R)-3-butyl-5-ethynyl-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C#C[C@@]1(CO)C[C@H](CCCC)C(n2ccc(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C15H20N2O4/c1-3-5-6-11-9-15(4-2,10-18)21-13(11)17-8-7-12(19)16-14(17)20/h2,7-8,11,13,18H,3,5-6,9-10H2,1H3,(H,16,19,20)/t11-,13?,15-/m0/s1 |
| InChIKey | ZQCVCHNCWIQWRR-BJLZJLDMSA-N |
| XLogP | 0.63 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|