C16H21F2N2O9P — CID 155094560
ethyl (2S)-4-[[(4aR,6R,7aR)-6-(2,4-dioxopyrimidin-1-yl)-7,7-difluoro-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]-2-methylbutanoate (PubChem CID 155094560) has the molecular formula C16H21F2N2O9P and a molecular weight of 454.32 g/mol. Its IUPAC name is ethyl (2S)-4-[[(4aR,6R,7aR)-6-(2,4-dioxopyrimidin-1-yl)-7,7-difluoro-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]-2-methylbutanoate.
| Compound Name | ethyl (2S)-4-[[(4aR,6R,7aR)-6-(2,4-dioxopyrimidin-1-yl)-7,7-difluoro-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]-2-methylbutanoate |
|---|---|
| PubChem CID | 155094560 |
| Molecular Formula | C16H21F2N2O9P |
| Molecular Weight | 454.32 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | ethyl (2S)-4-[[(4aR,6R,7aR)-6-(2,4-dioxopyrimidin-1-yl)-7,7-difluoro-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]-2-methylbutanoate |
| SMILES | CCOC(=O)[C@@H](C)CCOP1(=O)OC[C@H]2O[C@@H](n3ccc(=O)[nH]c3=O)C(F)(F)[C@@H]2O1 |
| InChI | InChI=1S/C16H21F2N2O9P/c1-3-25-13(22)9(2)5-7-26-30(24)27-8-10-12(29-30)16(17,18)14(28-10)20-6-4-11(21)19-15(20)23/h4,6,9-10,12,14H,3,5,7-8H2,1-2H3,(H,19,21,23)/t9-,10+,12+,14+,30?/m0/s1 |
| InChIKey | MJRULLPRCOBTGF-NVZDSWJJSA-N |
| XLogP | 1.20 |
| TPSA | 135.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.32 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|